74-Piece Professional Drawing Pencils and Sketch Set Includes Colored Pencil Sketch Charcoal Pastel Pencil Sharpener
Features: 72pcs professional drawing kit, greatly meeting your different using needs. Comfortable grip, easy to color, giving you a smooth painting experience. Includes 12 * Metallic Colored Pencil, 12 * Watercolor Pencils, 12 * Colored Pencil, 12 * Charcoal Pencil(So
SureChoice
@surechoiceĐánh giá
Theo Dõi
Nhận xét
Features: 72pcs professional drawing kit, greatly meeting your different using needs. Comfortable grip, easy to color, giving you a smooth painting experience. Includes 12 * Metallic Colored Pencil, 12 * Watercolor Pencils, 12 * Colored Pencil, 12 * Charcoal Pencil(Soft*4/Medium*4/Hard*4), 12 * Sketch Pencil(2H/3H/4H/5H/HB/B/2B/3B/4B/5B/6B/8B), 4 * Pastel Pencil, 3 * Paper Blending Stumps, 1 * Sandpaper Board, 1 * Eraser, 1 * Double Head Pencil Extender, 1 * Pencil Sharpener, 1 * Brush. Ideal for drawing, sketching, doodling, painting and calligraphy. Ergonomic design, it can be painted for a long time without tiredness. Equipped with a storage bag, which can protect each painting tool, easy to carry and store. Suitable for children, beginners, school student, office worker, artists, art enthusiasts, etc. Specifications:Quantity: 72pcs Art SetStorage Bag Size: 29.5 * 21.2 * 4.8cm / 11.6 * 8.3 * 1.9in Packing List:12 * Metallic Colored Pencil12 * Watercolor Pencils12 * Colored Pencil12 * Charcoal Pencil(Soft*4/Medium*4/Hard*4)12 * Sketch Pencil(2H/3H/4H/5H/HB/B/2B/3B/4B/5B/6B/8B)4 * Pastel Pencil3 * Paper Blending Stumps1 * Sandpaper Board1 * Eraser1 * Double Head Pencil Extender1 * Pencil Sharpener1 * BrushGiá sản phẩm trên Tiki đã bao gồm thuế theo luật hiện hành. Bên cạnh đó, tuỳ vào loại sản phẩm, hình thức và địa chỉ giao hàng mà có thể phát sinh thêm chi phí khác như phí vận chuyển, phụ phí hàng cồng kềnh, thuế nhập khẩu (đối với đơn hàng giao từ nước ngoài có giá trị trên 1 triệu đồng).....
Thương hiệu
OEM
Xuất xứ thương hiệu
China
Xuất xứ (Made in)
China
Sản phẩm có được bảo hành không?
Không
Sản Phẩm Tương Tự
Sản Phẩm Liên Quan
Xiaomi Mijia Đèn Ngủ Cảm biến ánh sáng Tiết Kiệm Năng Lượng (Trắng)
146.000₫
Đã bán 29
Đồng hồ báo thức thông minh bluetooth Xiaomi Youpin, kiểm soát độ ẩm và nhiệt độ, màn hình LCD
296.000₫
Đã bán 2